C13H12F13NO4S — CID 175009322
ethyl 2-methyl-3-[methyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)amino]prop-2-enoate (PubChem CID 175009322) has the molecular formula C13H12F13NO4S and a molecular weight of 525.28 g/mol. Its IUPAC name is ethyl 2-methyl-3-[methyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)amino]prop-2-enoate.
| Compound Name | ethyl 2-methyl-3-[methyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)amino]prop-2-enoate |
|---|---|
| PubChem CID | 175009322 |
| Molecular Formula | C13H12F13NO4S |
| Molecular Weight | 525.28 g/mol |
| Exact Mass | 525.03 |
| IUPAC Name | ethyl 2-methyl-3-[methyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)amino]prop-2-enoate |
| SMILES | CCOC(=O)C(C)=CN(C)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H12F13NO4S/c1-4-31-7(28)6(2)5-27(3)32(29,30)13(25,26)11(20,21)9(16,17)8(14,15)10(18,19)12(22,23)24/h5H,4H2,1-3H3 |
| InChIKey | FHYYRLPNKRDYHV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.28 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|