C9H5F13KNO4S — CID 162396476
potassium 2-[methyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)amino]acetate (PubChem CID 162396476) has the molecular formula C9H5F13KNO4S and a molecular weight of 509.28 g/mol. Its IUPAC name is potassium 2-[methyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)amino]acetate.
| Compound Name | potassium 2-[methyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)amino]acetate |
|---|---|
| PubChem CID | 162396476 |
| Molecular Formula | C9H5F13KNO4S |
| Molecular Weight | 509.28 g/mol |
| Exact Mass | 508.94 |
| IUPAC Name | potassium 2-[methyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)amino]acetate |
| SMILES | CN(CC(=O)[O-])S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[K+] |
| InChI | InChI=1S/C9H6F13NO4S.K/c1-23(2-3(24)25)28(26,27)9(21,22)7(16,17)5(12,13)4(10,11)6(14,15)8(18,19)20;/h2H2,1H3,(H,24,25);/q;+1/p-1 |
| InChIKey | BJCHQRMJXRUHFK-UHFFFAOYSA-M |
| XLogP | -1.30 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.28 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|