C12H20F9N2O3S+ — CID 162616316
diethyl-hydroxy-[3-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propyl]azanium (PubChem CID 162616316) has the molecular formula C12H20F9N2O3S+ and a molecular weight of 443.35 g/mol. Its IUPAC name is diethyl-hydroxy-[3-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propyl]azanium.
| Compound Name | diethyl-hydroxy-[3-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propyl]azanium |
|---|---|
| PubChem CID | 162616316 |
| Molecular Formula | C12H20F9N2O3S+ |
| Molecular Weight | 443.35 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | diethyl-hydroxy-[3-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propyl]azanium |
| SMILES | CC[N+](O)(CC)CCCN(C)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H20F9N2O3S/c1-4-23(24,5-2)8-6-7-22(3)27(25,26)12(20,21)10(15,16)9(13,14)11(17,18)19/h24H,4-8H2,1-3H3/q+1 |
| InChIKey | RHOKBNOKZCFKBR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|