C10H14F9NO3S — CID 130343065
1,1,2,2,3,3,4,4,4-nonafluoro-N-methyl-N-(2-propoxyethyl)butane-1-sulfonamide (PubChem CID 130343065) has the molecular formula C10H14F9NO3S and a molecular weight of 399.28 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluoro-N-methyl-N-(2-propoxyethyl)butane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N-methyl-N-(2-propoxyethyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 130343065 |
| Molecular Formula | C10H14F9NO3S |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N-methyl-N-(2-propoxyethyl)butane-1-sulfonamide |
| SMILES | CCCOCCN(C)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H14F9NO3S/c1-3-5-23-6-4-20(2)24(21,22)10(18,19)8(13,14)7(11,12)9(15,16)17/h3-6H2,1-2H3 |
| InChIKey | CKORICLXOQDQDP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|