C18H30F10O5S — CID 18995497
6-(2-hexoxyethoxy)hexyl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;hydrofluoride (PubChem CID 18995497) has the molecular formula C18H30F10O5S and a molecular weight of 548.48 g/mol. Its IUPAC name is 6-(2-hexoxyethoxy)hexyl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;hydrofluoride.
| Compound Name | 6-(2-hexoxyethoxy)hexyl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;hydrofluoride |
|---|---|
| PubChem CID | 18995497 |
| Molecular Formula | C18H30F10O5S |
| Molecular Weight | 548.48 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | 6-(2-hexoxyethoxy)hexyl 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;hydrofluoride |
| SMILES | CCCCCCOCCOCCCCCCOS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.F |
| InChI | InChI=1S/C18H29F9O5S.FH/c1-2-3-4-7-10-30-13-14-31-11-8-5-6-9-12-32-33(28,29)18(26,27)16(21,22)15(19,20)17(23,24)25;/h2-14H2,1H3;1H |
| InChIKey | HMYLBZCFTAKHMF-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.48 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|