C9H15F7O4S2 — CID 139975074
[butoxy(dimethyl)-λ4-sulfanyl] 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate (PubChem CID 139975074) has the molecular formula C9H15F7O4S2 and a molecular weight of 384.34 g/mol. Its IUPAC name is [butoxy(dimethyl)-λ4-sulfanyl] 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate.
| Compound Name | [butoxy(dimethyl)-λ4-sulfanyl] 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 139975074 |
| Molecular Formula | C9H15F7O4S2 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | [butoxy(dimethyl)-λ4-sulfanyl] 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate |
| SMILES | CCCCOS(C)(C)OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H15F7O4S2/c1-4-5-6-19-21(2,3)20-22(17,18)9(15,16)7(10,11)8(12,13)14/h4-6H2,1-3H3 |
| InChIKey | WSIDWEYVDHHAJO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|