C24H43F9O3S2 — CID 141102433
[diheptyl(hexyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 141102433) has the molecular formula C24H43F9O3S2 and a molecular weight of 614.72 g/mol. Its IUPAC name is [diheptyl(hexyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [diheptyl(hexyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 141102433 |
| Molecular Formula | C24H43F9O3S2 |
| Molecular Weight | 614.72 g/mol |
| Exact Mass | 614.25 |
| IUPAC Name | [diheptyl(hexyl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CCCCCCCS(CCCCCC)(CCCCCCC)OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H43F9O3S2/c1-4-7-10-13-16-19-37(18-15-12-9-6-3,20-17-14-11-8-5-2)36-38(34,35)24(32,33)22(27,28)21(25,26)23(29,30)31/h4-20H2,1-3H3 |
| InChIKey | JLAZUXNQRKYARP-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.72 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|