C13H17F12NO3S2 — CID 12064837
1,1,2,2,3,3,4,4,4-nonafluoro-N-[octyl-oxo-(trifluoromethyl)-lambda6-sulfanylidene]butane-1-sulfonamide (PubChem CID 12064837) has the molecular formula C13H17F12NO3S2 and a molecular weight of 527.39 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluoro-N-[octyl-oxo-(trifluoromethyl)-lambda6-sulfanylidene]butane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N-[octyl-oxo-(trifluoromethyl)-lambda6-sulfanylidene]butane-1-sulfonamide |
|---|---|
| PubChem CID | 12064837 |
| Molecular Formula | C13H17F12NO3S2 |
| Molecular Weight | 527.39 g/mol |
| Exact Mass | 527.05 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N-[octyl-oxo-(trifluoromethyl)-lambda6-sulfanylidene]butane-1-sulfonamide |
| SMILES | CCCCCCCCS(=O)(=NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H17F12NO3S2/c1-2-3-4-5-6-7-8-30(27,13(23,24)25)26-31(28,29)12(21,22)10(16,17)9(14,15)11(18,19)20/h2-8H2,1H3 |
| InChIKey | NTLWRHBFATZDLC-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.39 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|