C22H25F9O3S2 — CID 139982741
[dibutyl(naphthalen-1-yl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 139982741) has the molecular formula C22H25F9O3S2 and a molecular weight of 572.56 g/mol. Its IUPAC name is [dibutyl(naphthalen-1-yl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [dibutyl(naphthalen-1-yl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 139982741 |
| Molecular Formula | C22H25F9O3S2 |
| Molecular Weight | 572.56 g/mol |
| Exact Mass | 572.11 |
| IUPAC Name | [dibutyl(naphthalen-1-yl)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CCCCS(CCCC)(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H25F9O3S2/c1-3-5-14-35(15-6-4-2,18-13-9-11-16-10-7-8-12-17(16)18)34-36(32,33)22(30,31)20(25,26)19(23,24)21(27,28)29/h7-13H,3-6,14-15H2,1-2H3 |
| InChIKey | JDSDTORHWIFCSF-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.56 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|