C26H17F17O4S2 — CID 139974921
[(2-anthracen-9-yl-2-oxoethyl)-dimethyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate (PubChem CID 139974921) has the molecular formula C26H17F17O4S2 and a molecular weight of 780.52 g/mol. Its IUPAC name is [(2-anthracen-9-yl-2-oxoethyl)-dimethyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate.
| Compound Name | [(2-anthracen-9-yl-2-oxoethyl)-dimethyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate |
|---|---|
| PubChem CID | 139974921 |
| Molecular Formula | C26H17F17O4S2 |
| Molecular Weight | 780.52 g/mol |
| Exact Mass | 780.03 |
| IUPAC Name | [(2-anthracen-9-yl-2-oxoethyl)-dimethyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate |
| SMILES | CS(C)(CC(=O)c1c2ccccc2cc2ccccc12)OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C26H17F17O4S2/c1-48(2,12-17(44)18-15-9-5-3-7-13(15)11-14-8-4-6-10-16(14)18)47-49(45,46)26(42,43)24(37,38)22(33,34)20(29,30)19(27,28)21(31,32)23(35,36)25(39,40)41/h3-11H,12H2,1-2H3 |
| InChIKey | WTQZOPLADUGVML-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.52 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|