C15H9F7O2 — CID 146007268
2,2,3,3,4,4,4-heptafluoro-1-(2-methoxynaphthalen-1-yl)butan-1-one (PubChem CID 146007268) has the molecular formula C15H9F7O2 and a molecular weight of 354.22 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-1-(2-methoxynaphthalen-1-yl)butan-1-one.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-1-(2-methoxynaphthalen-1-yl)butan-1-one |
|---|---|
| PubChem CID | 146007268 |
| Molecular Formula | C15H9F7O2 |
| Molecular Weight | 354.22 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-1-(2-methoxynaphthalen-1-yl)butan-1-one |
| SMILES | COc1ccc2ccccc2c1C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H9F7O2/c1-24-10-7-6-8-4-2-3-5-9(8)11(10)12(23)13(16,17)14(18,19)15(20,21)22/h2-7H,1H3 |
| InChIKey | FRXIINFIVXJBJK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.22 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|