C14H15NO2 — CID 23279235
2-methoxy-N,N-dimethylnaphthalene-1-carboxamide (PubChem CID 23279235) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-methoxy-N,N-dimethylnaphthalene-1-carboxamide.
| Compound Name | 2-methoxy-N,N-dimethylnaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 23279235 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 2-methoxy-N,N-dimethylnaphthalene-1-carboxamide |
| SMILES | COc1ccc2ccccc2c1C(=O)N(C)C |
| InChI | InChI=1S/C14H15NO2/c1-15(2)14(16)13-11-7-5-4-6-10(11)8-9-12(13)17-3/h4-9H,1-3H3 |
| InChIKey | RKKKRFIJPIFIGE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |