C18H23NO3 — CID 10685706
2-(diethoxymethyl)-N,N-dimethylnaphthalene-1-carboxamide (PubChem CID 10685706) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-(diethoxymethyl)-N,N-dimethylnaphthalene-1-carboxamide.
| Compound Name | 2-(diethoxymethyl)-N,N-dimethylnaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 10685706 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 2-(diethoxymethyl)-N,N-dimethylnaphthalene-1-carboxamide |
| SMILES | CCOC(OCC)c1ccc2ccccc2c1C(=O)N(C)C |
| InChI | InChI=1S/C18H23NO3/c1-5-21-18(22-6-2)15-12-11-13-9-7-8-10-14(13)16(15)17(20)19(3)4/h7-12,18H,5-6H2,1-4H3 |
| InChIKey | OJVFTQNBIHHABO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|