C32H43NO2 — CID 10790677
N,N-di(heptan-4-yl)-2-[hydroxy(phenyl)methyl]naphthalene-1-carboxamide (PubChem CID 10790677) has the molecular formula C32H43NO2 and a molecular weight of 473.70 g/mol. Its IUPAC name is N,N-di(heptan-4-yl)-2-[hydroxy(phenyl)methyl]naphthalene-1-carboxamide.
| Compound Name | N,N-di(heptan-4-yl)-2-[hydroxy(phenyl)methyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 10790677 |
| Molecular Formula | C32H43NO2 |
| Molecular Weight | 473.70 g/mol |
| Exact Mass | 473.33 |
| IUPAC Name | N,N-di(heptan-4-yl)-2-[hydroxy(phenyl)methyl]naphthalene-1-carboxamide |
| SMILES | CCCC(CCC)N(C(=O)c1c(C(O)c2ccccc2)ccc2ccccc12)C(CCC)CCC |
| InChI | InChI=1S/C32H43NO2/c1-5-14-26(15-6-2)33(27(16-7-3)17-8-4)32(35)30-28-21-13-12-18-24(28)22-23-29(30)31(34)25-19-10-9-11-20-25/h9-13,18-23,26-27,31,34H,5-8,14-17H2,1-4H3 |
| InChIKey | ISJOKMBIUWGQEL-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.70 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |