C18H23NO — CID 15828026
2-methyl-N,N-di(propan-2-yl)naphthalene-1-carboxamide (PubChem CID 15828026) has the molecular formula C18H23NO and a molecular weight of 269.39 g/mol. Its IUPAC name is 2-methyl-N,N-di(propan-2-yl)naphthalene-1-carboxamide.
| Compound Name | 2-methyl-N,N-di(propan-2-yl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 15828026 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 2-methyl-N,N-di(propan-2-yl)naphthalene-1-carboxamide |
| SMILES | Cc1ccc2ccccc2c1C(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C18H23NO/c1-12(2)19(13(3)4)18(20)17-14(5)10-11-15-8-6-7-9-16(15)17/h6-13H,1-5H3 |
| InChIKey | JHZSHWRPRFZHER-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |