C22H33NOSi — CID 101183302
N,N-di(propan-2-yl)-2-[(1R)-1-trimethylsilylethyl]naphthalene-1-carboxamide (PubChem CID 101183302) has the molecular formula C22H33NOSi and a molecular weight of 355.60 g/mol. Its IUPAC name is N,N-di(propan-2-yl)-2-[(1R)-1-trimethylsilylethyl]naphthalene-1-carboxamide.
| Compound Name | N,N-di(propan-2-yl)-2-[(1R)-1-trimethylsilylethyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 101183302 |
| Molecular Formula | C22H33NOSi |
| Molecular Weight | 355.60 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | N,N-di(propan-2-yl)-2-[(1R)-1-trimethylsilylethyl]naphthalene-1-carboxamide |
| SMILES | CC(C)N(C(=O)c1c([C@@H](C)[Si](C)(C)C)ccc2ccccc12)C(C)C |
| InChI | InChI=1S/C22H33NOSi/c1-15(2)23(16(3)4)22(24)21-19(17(5)25(6,7)8)14-13-18-11-9-10-12-20(18)21/h9-17H,1-8H3/t17-/m1/s1 |
| InChIKey | OTHRFAHZSAQLPT-QGZVFWFLSA-N |
| XLogP | 6.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.60 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|