About 2-[(2R)-butan-2-yl]-N,N-di(propan-2-yl)naphthalene-1-carboxamide
2-[(2R)-butan-2-yl]-N,N-di(propan-2-yl)naphthalene-1-carboxamide (PubChem CID 102067521) has the molecular formula C21H29NO
and a molecular weight of 311.47 g/mol. Its IUPAC name is 2-[(2R)-butan-2-yl]-N,N-di(propan-2-yl)naphthalene-1-carboxamide.
Molecular Properties
| Compound Name | 2-[(2R)-butan-2-yl]-N,N-di(propan-2-yl)naphthalene-1-carboxamide |
| PubChem CID | 102067521 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 2-[(2R)-butan-2-yl]-N,N-di(propan-2-yl)naphthalene-1-carboxamide |
| SMILES | CC[C@@H](C)c1ccc2ccccc2c1C(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C21H29NO/c1-7-16(6)18-13-12-17-10-8-9-11-19(17)20(18)21(23)22(14(2)3)15(4)5/h8-16H,7H2,1-6H3/t16-/m1/s1 |
| InChIKey | OKQZDOGSDAPQFG-MRXNPFEDSA-N |
| XLogP | 5.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(2R)-butan-2-yl]-N,N-di(propan-2-yl)naphthalene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R)-butan-2-yl]-N,N-di(propan-2-yl)naphthalene-1-carboxamide?
The IUPAC name of 2-[(2R)-butan-2-yl]-N,N-di(propan-2-yl)naphthalene-1-carboxamide (CID 102067521) is 2-[(2R)-butan-2-yl]-N,N-di(propan-2-yl)naphthalene-1-carboxamide.
What is the SMILES notation for 2-[(2R)-butan-2-yl]-N,N-di(propan-2-yl)naphthalene-1-carboxamide?
The canonical SMILES for 2-[(2R)-butan-2-yl]-N,N-di(propan-2-yl)naphthalene-1-carboxamide is CC[C@@H](C)c1ccc2ccccc2c1C(=O)N(C(C)C)C(C)C.
What is the InChIKey of 2-[(2R)-butan-2-yl]-N,N-di(propan-2-yl)naphthalene-1-carboxamide?
The InChIKey is OKQZDOGSDAPQFG-MRXNPFEDSA-N. The full InChI is InChI=1S/C21H29NO/c1-7-16(6)18-13-12-17-10-8-9-11-19(17)20(18)21(23)22(14(2)3)15(4)5/h8-16H,7H2,1-6H3/t16-/m1/s1.
What are the key properties of 2-[(2R)-butan-2-yl]-N,N-di(propan-2-yl)naphthalene-1-carboxamide?
2-[(2R)-butan-2-yl]-N,N-di(propan-2-yl)naphthalene-1-carboxamide has a molecular weight of 311.47 g/mol, XLogP of 5.61, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R)-butan-2-yl]-N,N-di(propan-2-yl)naphthalene-1-carboxamide is sourced from PubChem (CID 102067521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).