C16H13F9O4S2 — CID 139975199
[dimethyl(naphthalen-2-yloxy)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 139975199) has the molecular formula C16H13F9O4S2 and a molecular weight of 504.39 g/mol. Its IUPAC name is [dimethyl(naphthalen-2-yloxy)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [dimethyl(naphthalen-2-yloxy)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 139975199 |
| Molecular Formula | C16H13F9O4S2 |
| Molecular Weight | 504.39 g/mol |
| Exact Mass | 504.01 |
| IUPAC Name | [dimethyl(naphthalen-2-yloxy)-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CS(C)(Oc1ccc2ccccc2c1)OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H13F9O4S2/c1-30(2,28-12-8-7-10-5-3-4-6-11(10)9-12)29-31(26,27)16(24,25)14(19,20)13(17,18)15(21,22)23/h3-9H,1-2H3 |
| InChIKey | UEOWQDKFKOURCZ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.39 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|