C26H24F18O4S3 — CID 174746405
3-(1-butoxynaphthalen-2-yl)thiolane;fluoro 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate;sulfane (PubChem CID 174746405) has the molecular formula C26H24F18O4S3 and a molecular weight of 838.64 g/mol. Its IUPAC name is 3-(1-butoxynaphthalen-2-yl)thiolane;fluoro 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate;sulfane.
| Compound Name | 3-(1-butoxynaphthalen-2-yl)thiolane;fluoro 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate;sulfane |
|---|---|
| PubChem CID | 174746405 |
| Molecular Formula | C26H24F18O4S3 |
| Molecular Weight | 838.64 g/mol |
| Exact Mass | 838.05 |
| IUPAC Name | 3-(1-butoxynaphthalen-2-yl)thiolane;fluoro 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate;sulfane |
| SMILES | CCCCOc1c(C2CCSC2)ccc2ccccc12.O=S(=O)(OF)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.S |
| InChI | InChI=1S/C18H22OS.C8F18O3S.H2S/c1-2-3-11-19-18-16-7-5-4-6-14(16)8-9-17(18)15-10-12-20-13-15;9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)30(27,28)29-26;/h4-9,15H,2-3,10-13H2,1H3;;1H2 |
| InChIKey | LIEFEOMEHKPQMB-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.64 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|