C19H23F3O4S2 — CID 23102978
3-(2-butoxynaphthalen-1-yl)thiolan-1-ium;trifluoromethanesulfonate (PubChem CID 23102978) has the molecular formula C19H23F3O4S2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 3-(2-butoxynaphthalen-1-yl)thiolan-1-ium;trifluoromethanesulfonate.
| Compound Name | 3-(2-butoxynaphthalen-1-yl)thiolan-1-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 23102978 |
| Molecular Formula | C19H23F3O4S2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 3-(2-butoxynaphthalen-1-yl)thiolan-1-ium;trifluoromethanesulfonate |
| SMILES | CCCCOc1ccc2ccccc2c1C1CC[SH+]C1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C18H22OS.CHF3O3S/c1-2-3-11-19-17-9-8-14-6-4-5-7-16(14)18(17)15-10-12-20-13-15;2-1(3,4)8(5,6)7/h4-9,15H,2-3,10-13H2,1H3;(H,5,6,7) |
| InChIKey | ZFARVVOFSKTNDG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|