C19H19F3O4S2 — CID 174882352
3-butoxy-2-naphthalen-1-ylthiophene;trifluoromethanesulfonic acid (PubChem CID 174882352) has the molecular formula C19H19F3O4S2 and a molecular weight of 432.49 g/mol. Its IUPAC name is 3-butoxy-2-naphthalen-1-ylthiophene;trifluoromethanesulfonic acid.
| Compound Name | 3-butoxy-2-naphthalen-1-ylthiophene;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 174882352 |
| Molecular Formula | C19H19F3O4S2 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 3-butoxy-2-naphthalen-1-ylthiophene;trifluoromethanesulfonic acid |
| SMILES | CCCCOc1ccsc1-c1cccc2ccccc12.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C18H18OS.CHF3O3S/c1-2-3-12-19-17-11-13-20-18(17)16-10-6-8-14-7-4-5-9-15(14)16;2-1(3,4)8(5,6)7/h4-11,13H,2-3,12H2,1H3;(H,5,6,7) |
| InChIKey | GVIBEEJTDPZVIX-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|