C35H47F3O5S2 — CID 173109220
2,3-bis(4-octoxyphenyl)benzenethiol;trifluoromethanesulfonic acid (PubChem CID 173109220) has the molecular formula C35H47F3O5S2 and a molecular weight of 668.88 g/mol. Its IUPAC name is 2,3-bis(4-octoxyphenyl)benzenethiol;trifluoromethanesulfonic acid.
| Compound Name | 2,3-bis(4-octoxyphenyl)benzenethiol;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 173109220 |
| Molecular Formula | C35H47F3O5S2 |
| Molecular Weight | 668.88 g/mol |
| Exact Mass | 668.28 |
| IUPAC Name | 2,3-bis(4-octoxyphenyl)benzenethiol;trifluoromethanesulfonic acid |
| SMILES | CCCCCCCCOc1ccc(-c2cccc(S)c2-c2ccc(OCCCCCCCC)cc2)cc1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C34H46O2S.CHF3O3S/c1-3-5-7-9-11-13-26-35-30-22-18-28(19-23-30)32-16-15-17-33(37)34(32)29-20-24-31(25-21-29)36-27-14-12-10-8-6-4-2;2-1(3,4)8(5,6)7/h15-25,37H,3-14,26-27H2,1-2H3;(H,5,6,7) |
| InChIKey | TYOLSJVDPGCZOV-UHFFFAOYSA-N |
| XLogP | 11.18 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.88 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|