C31H35F3O9S2 — CID 173327690
tert-butyl 2-[4-[2-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-3-sulfanylphenyl]phenoxy]acetate;trifluoromethanesulfonic acid (PubChem CID 173327690) has the molecular formula C31H35F3O9S2 and a molecular weight of 672.74 g/mol. Its IUPAC name is tert-butyl 2-[4-[2-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-3-sulfanylphenyl]phenoxy]acetate;trifluoromethanesulfonic acid.
| Compound Name | tert-butyl 2-[4-[2-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-3-sulfanylphenyl]phenoxy]acetate;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 173327690 |
| Molecular Formula | C31H35F3O9S2 |
| Molecular Weight | 672.74 g/mol |
| Exact Mass | 672.17 |
| IUPAC Name | tert-butyl 2-[4-[2-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-3-sulfanylphenyl]phenoxy]acetate;trifluoromethanesulfonic acid |
| SMILES | CC(C)(C)OC(=O)COc1ccc(-c2cccc(S)c2-c2ccc(OCC(=O)OC(C)(C)C)cc2)cc1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C30H34O6S.CHF3O3S/c1-29(2,3)35-26(31)18-33-22-14-10-20(11-15-22)24-8-7-9-25(37)28(24)21-12-16-23(17-13-21)34-19-27(32)36-30(4,5)6;2-1(3,4)8(5,6)7/h7-17,37H,18-19H2,1-6H3;(H,5,6,7) |
| InChIKey | JKHFZSKIFKHPIM-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.74 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|