C22H23N3O4 — CID 169132696
tert-butyl 2-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]phenoxy]acetate (PubChem CID 169132696) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is tert-butyl 2-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 169132696 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | tert-butyl 2-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]phenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1ccc(-c2cc(-c3ccccc3O)nnc2N)cc1 |
| InChI | InChI=1S/C22H23N3O4/c1-22(2,3)29-20(27)13-28-15-10-8-14(9-11-15)17-12-18(24-25-21(17)23)16-6-4-5-7-19(16)26/h4-12,26H,13H2,1-3H3,(H2,23,25) |
| InChIKey | RKCXTTONWBDWGV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |