C26H31N7O3 — CID 139545931
tert-butyl 4-[4-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]pyrazol-1-yl]but-2-ynyl]piperazine-1-carboxylate (PubChem CID 139545931) has the molecular formula C26H31N7O3 and a molecular weight of 489.58 g/mol. Its IUPAC name is tert-butyl 4-[4-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]pyrazol-1-yl]but-2-ynyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]pyrazol-1-yl]but-2-ynyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 139545931 |
| Molecular Formula | C26H31N7O3 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | tert-butyl 4-[4-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]pyrazol-1-yl]but-2-ynyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC#CCn2cc(-c3cc(-c4ccccc4O)nnc3N)cn2)CC1 |
| InChI | InChI=1S/C26H31N7O3/c1-26(2,3)36-25(35)32-14-12-31(13-15-32)10-6-7-11-33-18-19(17-28-33)21-16-22(29-30-24(21)27)20-8-4-5-9-23(20)34/h4-5,8-9,16-18,34H,10-15H2,1-3H3,(H2,27,30) |
| InChIKey | XZUOOIWFRUUPCF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|