C29H38N6O3 — CID 155390943
tert-butyl N-[3-[4-[[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]phenyl]methyl]piperazin-1-yl]propyl]carbamate (PubChem CID 155390943) has the molecular formula C29H38N6O3 and a molecular weight of 518.66 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]phenyl]methyl]piperazin-1-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]phenyl]methyl]piperazin-1-yl]propyl]carbamate |
|---|---|
| PubChem CID | 155390943 |
| Molecular Formula | C29H38N6O3 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | tert-butyl N-[3-[4-[[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]phenyl]methyl]piperazin-1-yl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCN1CCN(Cc2ccc(-c3cc(-c4ccccc4O)nnc3N)cc2)CC1 |
| InChI | InChI=1S/C29H38N6O3/c1-29(2,3)38-28(37)31-13-6-14-34-15-17-35(18-16-34)20-21-9-11-22(12-10-21)24-19-25(32-33-27(24)30)23-7-4-5-8-26(23)36/h4-5,7-12,19,36H,6,13-18,20H2,1-3H3,(H2,30,33)(H,31,37) |
| InChIKey | HLNXQBSYJOKPFS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|