C17H28N4O2S2 — CID 88677924
carbamothioic S-acid;O-methyl N-[3-(4-benzylpiperazin-1-yl)propyl]carbamothioate (PubChem CID 88677924) has the molecular formula C17H28N4O2S2 and a molecular weight of 384.57 g/mol. Its IUPAC name is carbamothioic S-acid;O-methyl N-[3-(4-benzylpiperazin-1-yl)propyl]carbamothioate.
| Compound Name | carbamothioic S-acid;O-methyl N-[3-(4-benzylpiperazin-1-yl)propyl]carbamothioate |
|---|---|
| PubChem CID | 88677924 |
| Molecular Formula | C17H28N4O2S2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | carbamothioic S-acid;O-methyl N-[3-(4-benzylpiperazin-1-yl)propyl]carbamothioate |
| SMILES | COC(=S)NCCCN1CCN(Cc2ccccc2)CC1.NC(=O)S |
| InChI | InChI=1S/C16H25N3OS.CH3NOS/c1-20-16(21)17-8-5-9-18-10-12-19(13-11-18)14-15-6-3-2-4-7-15;2-1(3)4/h2-4,6-7H,5,8-14H2,1H3,(H,17,21);(H3,2,3,4) |
| InChIKey | JBONUFVGNAUYNN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|