C26H36N4O3 — CID 52656160
N-[3-(4-benzylpiperazin-1-yl)propyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 52656160) has the molecular formula C26H36N4O3 and a molecular weight of 452.60 g/mol. Its IUPAC name is N-[3-(4-benzylpiperazin-1-yl)propyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 52656160 |
| Molecular Formula | C26H36N4O3 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | COc1cc2c(cc1OC)CN(C(=O)NCCCN1CCN(Cc3ccccc3)CC1)CC2 |
| InChI | InChI=1S/C26H36N4O3/c1-32-24-17-22-9-12-30(20-23(22)18-25(24)33-2)26(31)27-10-6-11-28-13-15-29(16-14-28)19-21-7-4-3-5-8-21/h3-5,7-8,17-18H,6,9-16,19-20H2,1-2H3,(H,27,31) |
| InChIKey | RTXGHVSQNMLMBN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|