C18H26N2O5 — CID 122021420
4-[(6,7-diethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)amino]butanoic acid (PubChem CID 122021420) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is 4-[(6,7-diethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)amino]butanoic acid.
| Compound Name | 4-[(6,7-diethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 122021420 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 4-[(6,7-diethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)amino]butanoic acid |
| SMILES | CCOc1cc2c(cc1OCC)CN(C(=O)NCCCC(=O)O)CC2 |
| InChI | InChI=1S/C18H26N2O5/c1-3-24-15-10-13-7-9-20(12-14(13)11-16(15)25-4-2)18(23)19-8-5-6-17(21)22/h10-11H,3-9,12H2,1-2H3,(H,19,23)(H,21,22) |
| InChIKey | LORUMLBBIGJHNP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|