C26H33N5O4 — CID 168901250
2-[6-amino-5-(2-cyclobutylethynyl)pyridazin-3-yl]phenol;tert-butyl 4-nitrosopiperidine-1-carboxylate (PubChem CID 168901250) has the molecular formula C26H33N5O4 and a molecular weight of 479.58 g/mol. Its IUPAC name is 2-[6-amino-5-(2-cyclobutylethynyl)pyridazin-3-yl]phenol;tert-butyl 4-nitrosopiperidine-1-carboxylate.
| Compound Name | 2-[6-amino-5-(2-cyclobutylethynyl)pyridazin-3-yl]phenol;tert-butyl 4-nitrosopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 168901250 |
| Molecular Formula | C26H33N5O4 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | 2-[6-amino-5-(2-cyclobutylethynyl)pyridazin-3-yl]phenol;tert-butyl 4-nitrosopiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N=O)CC1.Nc1nnc(-c2ccccc2O)cc1C#CC1CCC1 |
| InChI | InChI=1S/C16H15N3O.C10H18N2O3/c17-16-12(9-8-11-4-3-5-11)10-14(18-19-16)13-6-1-2-7-15(13)20;1-10(2,3)15-9(13)12-6-4-8(11-14)5-7-12/h1-2,6-7,10-11,20H,3-5H2,(H2,17,19);8H,4-7H2,1-3H3 |
| InChIKey | CIOSNMAVNRDZPN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|