C17H24N6O2 — CID 155390752
tert-butyl 4-[3-amino-6-(1H-pyrazol-5-yl)pyridazin-4-yl]piperidine-1-carboxylate (PubChem CID 155390752) has the molecular formula C17H24N6O2 and a molecular weight of 344.42 g/mol. Its IUPAC name is tert-butyl 4-[3-amino-6-(1H-pyrazol-5-yl)pyridazin-4-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-amino-6-(1H-pyrazol-5-yl)pyridazin-4-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155390752 |
| Molecular Formula | C17H24N6O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | tert-butyl 4-[3-amino-6-(1H-pyrazol-5-yl)pyridazin-4-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cc(-c3ccn[nH]3)nnc2N)CC1 |
| InChI | InChI=1S/C17H24N6O2/c1-17(2,3)25-16(24)23-8-5-11(6-9-23)12-10-14(21-22-15(12)18)13-4-7-19-20-13/h4,7,10-11H,5-6,8-9H2,1-3H3,(H2,18,22)(H,19,20) |
| InChIKey | BJACGMBEYJKJAR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |