C16H18N4O3 — CID 137045885
4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperidine-1-carboxylic acid (PubChem CID 137045885) has the molecular formula C16H18N4O3 and a molecular weight of 314.34 g/mol. Its IUPAC name is 4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperidine-1-carboxylic acid.
| Compound Name | 4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 137045885 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperidine-1-carboxylic acid |
| SMILES | Nc1nnc(-c2ccccc2O)cc1C1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C16H18N4O3/c17-15-12(10-5-7-20(8-6-10)16(22)23)9-13(18-19-15)11-3-1-2-4-14(11)21/h1-4,9-10,21H,5-8H2,(H2,17,19)(H,22,23) |
| InChIKey | SGTGAQVUUSIRJG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |