C18H25N5O2 — CID 160949822
1-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazin-1-yl]ethanone;ethane (PubChem CID 160949822) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 1-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazin-1-yl]ethanone;ethane.
| Compound Name | 1-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazin-1-yl]ethanone;ethane |
|---|---|
| PubChem CID | 160949822 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 1-[4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]piperazin-1-yl]ethanone;ethane |
| SMILES | CC.CC(=O)N1CCN(c2cc(-c3ccccc3O)nnc2N)CC1 |
| InChI | InChI=1S/C16H19N5O2.C2H6/c1-11(22)20-6-8-21(9-7-20)14-10-13(18-19-16(14)17)12-4-2-3-5-15(12)23;1-2/h2-5,10,23H,6-9H2,1H3,(H2,17,19);1-2H3 |
| InChIKey | SVPJKLSLTJTSRF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |