C19H31N5O — CID 171638010
2-[6-amino-5-(4-methylpiperazin-1-yl)pyridazin-3-yl]phenol;ethane (PubChem CID 171638010) has the molecular formula C19H31N5O and a molecular weight of 345.49 g/mol. Its IUPAC name is 2-[6-amino-5-(4-methylpiperazin-1-yl)pyridazin-3-yl]phenol;ethane.
| Compound Name | 2-[6-amino-5-(4-methylpiperazin-1-yl)pyridazin-3-yl]phenol;ethane |
|---|---|
| PubChem CID | 171638010 |
| Molecular Formula | C19H31N5O |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | 2-[6-amino-5-(4-methylpiperazin-1-yl)pyridazin-3-yl]phenol;ethane |
| SMILES | CC.CC.CN1CCN(c2cc(-c3ccccc3O)nnc2N)CC1 |
| InChI | InChI=1S/C15H19N5O.2C2H6/c1-19-6-8-20(9-7-19)13-10-12(17-18-15(13)16)11-4-2-3-5-14(11)21;2*1-2/h2-5,10,21H,6-9H2,1H3,(H2,16,18);2*1-2H3 |
| InChIKey | LPSHMJUHSGVPQL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |