C16H20N4O2 — CID 137029504
2-[6-amino-5-[(2R,6R)-2,6-dimethylmorpholin-4-yl]pyridazin-3-yl]phenol (PubChem CID 137029504) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-[6-amino-5-[(2R,6R)-2,6-dimethylmorpholin-4-yl]pyridazin-3-yl]phenol.
| Compound Name | 2-[6-amino-5-[(2R,6R)-2,6-dimethylmorpholin-4-yl]pyridazin-3-yl]phenol |
|---|---|
| PubChem CID | 137029504 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2-[6-amino-5-[(2R,6R)-2,6-dimethylmorpholin-4-yl]pyridazin-3-yl]phenol |
| SMILES | C[C@@H]1CN(c2cc(-c3ccccc3O)nnc2N)C[C@@H](C)O1 |
| InChI | InChI=1S/C16H20N4O2/c1-10-8-20(9-11(2)22-10)14-7-13(18-19-16(14)17)12-5-3-4-6-15(12)21/h3-7,10-11,21H,8-9H2,1-2H3,(H2,17,19)/t10-,11-/m1/s1 |
| InChIKey | LTQBMPHICDLNOB-GHMZBOCLSA-N |
| XLogP | 2.05 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |