C29H32F6O5S2 — CID 173271696
2,3-bis(4-butoxyphenyl)benzenethiol;1,1,2,3,3,3-hexafluoropropane-1-sulfonic acid (PubChem CID 173271696) has the molecular formula C29H32F6O5S2 and a molecular weight of 638.69 g/mol. Its IUPAC name is 2,3-bis(4-butoxyphenyl)benzenethiol;1,1,2,3,3,3-hexafluoropropane-1-sulfonic acid.
| Compound Name | 2,3-bis(4-butoxyphenyl)benzenethiol;1,1,2,3,3,3-hexafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 173271696 |
| Molecular Formula | C29H32F6O5S2 |
| Molecular Weight | 638.69 g/mol |
| Exact Mass | 638.16 |
| IUPAC Name | 2,3-bis(4-butoxyphenyl)benzenethiol;1,1,2,3,3,3-hexafluoropropane-1-sulfonic acid |
| SMILES | CCCCOc1ccc(-c2cccc(S)c2-c2ccc(OCCCC)cc2)cc1.O=S(=O)(O)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C26H30O2S.C3H2F6O3S/c1-3-5-18-27-22-14-10-20(11-15-22)24-8-7-9-25(29)26(24)21-12-16-23(17-13-21)28-19-6-4-2;4-1(2(5,6)7)3(8,9)13(10,11)12/h7-17,29H,3-6,18-19H2,1-2H3;1H,(H,10,11,12) |
| InChIKey | GOGGKWOZCFNBMW-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.69 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|