C35H45F3O5S — CID 87567544
[2,3-bis(4-octoxyphenyl)phenyl] trifluoromethanesulfonate (PubChem CID 87567544) has the molecular formula C35H45F3O5S and a molecular weight of 634.80 g/mol. Its IUPAC name is [2,3-bis(4-octoxyphenyl)phenyl] trifluoromethanesulfonate.
| Compound Name | [2,3-bis(4-octoxyphenyl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87567544 |
| Molecular Formula | C35H45F3O5S |
| Molecular Weight | 634.80 g/mol |
| Exact Mass | 634.29 |
| IUPAC Name | [2,3-bis(4-octoxyphenyl)phenyl] trifluoromethanesulfonate |
| SMILES | CCCCCCCCOc1ccc(-c2cccc(OS(=O)(=O)C(F)(F)F)c2-c2ccc(OCCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C35H45F3O5S/c1-3-5-7-9-11-13-26-41-30-22-18-28(19-23-30)32-16-15-17-33(43-44(39,40)35(36,37)38)34(32)29-20-24-31(25-21-29)42-27-14-12-10-8-6-4-2/h15-25H,3-14,26-27H2,1-2H3 |
| InChIKey | KUMDVPOKZUSLLS-UHFFFAOYSA-N |
| XLogP | 10.73 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.80 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|