C16H16F2O — CID 59931484
2-(4-butoxyphenyl)-1,3-difluorobenzene (PubChem CID 59931484) has the molecular formula C16H16F2O and a molecular weight of 262.30 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-1,3-difluorobenzene.
| Compound Name | 2-(4-butoxyphenyl)-1,3-difluorobenzene |
|---|---|
| PubChem CID | 59931484 |
| Molecular Formula | C16H16F2O |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 2-(4-butoxyphenyl)-1,3-difluorobenzene |
| SMILES | CCCCOc1ccc(-c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C16H16F2O/c1-2-3-11-19-13-9-7-12(8-10-13)16-14(17)5-4-6-15(16)18/h4-10H,2-3,11H2,1H3 |
| InChIKey | YZMQAAVSANWQMV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|