C21H23F2NO3 — CID 19041140
4-[2-(4-butoxyphenoxy)ethyl]-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 19041140) has the molecular formula C21H23F2NO3 and a molecular weight of 375.42 g/mol. Its IUPAC name is 4-[2-(4-butoxyphenoxy)ethyl]-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 4-[2-(4-butoxyphenoxy)ethyl]-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 19041140 |
| Molecular Formula | C21H23F2NO3 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 4-[2-(4-butoxyphenoxy)ethyl]-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | CCCCOc1ccc(OCCC2COC(c3c(F)cccc3F)=N2)cc1 |
| InChI | InChI=1S/C21H23F2NO3/c1-2-3-12-25-16-7-9-17(10-8-16)26-13-11-15-14-27-21(24-15)20-18(22)5-4-6-19(20)23/h4-10,15H,2-3,11-14H2,1H3 |
| InChIKey | WWUZRXJPPAAIEV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|