C25H31F2NO2 — CID 15008050
2-(2,6-difluorophenyl)-4-(2-methoxy-4-nonylphenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 15008050) has the molecular formula C25H31F2NO2 and a molecular weight of 415.52 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-4-(2-methoxy-4-nonylphenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-(2,6-difluorophenyl)-4-(2-methoxy-4-nonylphenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 15008050 |
| Molecular Formula | C25H31F2NO2 |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 2-(2,6-difluorophenyl)-4-(2-methoxy-4-nonylphenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | CCCCCCCCCc1ccc(C2COC(c3c(F)cccc3F)=N2)c(OC)c1 |
| InChI | InChI=1S/C25H31F2NO2/c1-3-4-5-6-7-8-9-11-18-14-15-19(23(16-18)29-2)22-17-30-25(28-22)24-20(26)12-10-13-21(24)27/h10,12-16,22H,3-9,11,17H2,1-2H3 |
| InChIKey | AEQWTGBXWFJVBW-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|