C19H15F6NO2 — CID 139794188
4-(4-butoxy-2,3,5,6-tetrafluorophenyl)-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 139794188) has the molecular formula C19H15F6NO2 and a molecular weight of 403.32 g/mol. Its IUPAC name is 4-(4-butoxy-2,3,5,6-tetrafluorophenyl)-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 4-(4-butoxy-2,3,5,6-tetrafluorophenyl)-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 139794188 |
| Molecular Formula | C19H15F6NO2 |
| Molecular Weight | 403.32 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 4-(4-butoxy-2,3,5,6-tetrafluorophenyl)-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | CCCCOc1c(F)c(F)c(C2COC(c3c(F)cccc3F)=N2)c(F)c1F |
| InChI | InChI=1S/C19H15F6NO2/c1-2-3-7-27-18-16(24)14(22)13(15(23)17(18)25)11-8-28-19(26-11)12-9(20)5-4-6-10(12)21/h4-6,11H,2-3,7-8H2,1H3 |
| InChIKey | HLIRUTIMHFKSKB-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.32 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|