C29H37F2NO3 — CID 142672364
4-[4-(4,4-dibutoxycyclohexyl)phenyl]-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 142672364) has the molecular formula C29H37F2NO3 and a molecular weight of 485.62 g/mol. Its IUPAC name is 4-[4-(4,4-dibutoxycyclohexyl)phenyl]-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 4-[4-(4,4-dibutoxycyclohexyl)phenyl]-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 142672364 |
| Molecular Formula | C29H37F2NO3 |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | 4-[4-(4,4-dibutoxycyclohexyl)phenyl]-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | CCCCOC1(OCCCC)CCC(c2ccc(C3COC(c4c(F)cccc4F)=N3)cc2)CC1 |
| InChI | InChI=1S/C29H37F2NO3/c1-3-5-18-34-29(35-19-6-4-2)16-14-22(15-17-29)21-10-12-23(13-11-21)26-20-33-28(32-26)27-24(30)8-7-9-25(27)31/h7-13,22,26H,3-6,14-20H2,1-2H3 |
| InChIKey | NHHNYBGDWAOEGT-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|