C21H14F3NO4S — CID 166985609
[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 166985609) has the molecular formula C21H14F3NO4S and a molecular weight of 433.41 g/mol. Its IUPAC name is [4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 166985609 |
| Molecular Formula | C21H14F3NO4S |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | [4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | O=S(=O)(Oc1ccc(C2COC(c3c(F)cccc3F)=N2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H14F3NO4S/c22-14-6-10-16(11-7-14)30(26,27)29-15-8-4-13(5-9-15)19-12-28-21(25-19)20-17(23)2-1-3-18(20)24/h1-11,19H,12H2 |
| InChIKey | FNDLBNAZQLPZAU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|