C25H35F3O3S3 — CID 173291092
3-hexyl-2-(4-hexylsulfanylphenyl)benzenethiol;trifluoromethanesulfonic acid (PubChem CID 173291092) has the molecular formula C25H35F3O3S3 and a molecular weight of 536.75 g/mol. Its IUPAC name is 3-hexyl-2-(4-hexylsulfanylphenyl)benzenethiol;trifluoromethanesulfonic acid.
| Compound Name | 3-hexyl-2-(4-hexylsulfanylphenyl)benzenethiol;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 173291092 |
| Molecular Formula | C25H35F3O3S3 |
| Molecular Weight | 536.75 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | 3-hexyl-2-(4-hexylsulfanylphenyl)benzenethiol;trifluoromethanesulfonic acid |
| SMILES | CCCCCCSc1ccc(-c2c(S)cccc2CCCCCC)cc1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C24H34S2.CHF3O3S/c1-3-5-7-9-12-20-13-11-14-23(25)24(20)21-15-17-22(18-16-21)26-19-10-8-6-4-2;2-1(3,4)8(5,6)7/h11,13-18,25H,3-10,12,19H2,1-2H3;(H,5,6,7) |
| InChIKey | KOKOCGSBFSZTIV-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.75 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|