C23H28F4O3S2 — CID 87903046
[diethyl(naphthalen-1-yl)-λ4-sulfanyl] 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 87903046) has the molecular formula C23H28F4O3S2 and a molecular weight of 492.60 g/mol. Its IUPAC name is [diethyl(naphthalen-1-yl)-λ4-sulfanyl] 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | [diethyl(naphthalen-1-yl)-λ4-sulfanyl] 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 87903046 |
| Molecular Formula | C23H28F4O3S2 |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | [diethyl(naphthalen-1-yl)-λ4-sulfanyl] 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | CCS(CC)(OS(=O)(=O)C(F)(F)C(F)(F)C1CC2CCC1C2)c1cccc2ccccc12 |
| InChI | InChI=1S/C23H28F4O3S2/c1-3-31(4-2,21-11-7-9-17-8-5-6-10-19(17)21)30-32(28,29)23(26,27)22(24,25)20-15-16-12-13-18(20)14-16/h5-11,16,18,20H,3-4,12-15H2,1-2H3 |
| InChIKey | WYMNDWBXFKQALC-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|