C13H15F7O4S2 — CID 139975146
[(4-methoxyphenyl)methyl-dimethyl-λ4-sulfanyl] 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate (PubChem CID 139975146) has the molecular formula C13H15F7O4S2 and a molecular weight of 432.38 g/mol. Its IUPAC name is [(4-methoxyphenyl)methyl-dimethyl-λ4-sulfanyl] 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate.
| Compound Name | [(4-methoxyphenyl)methyl-dimethyl-λ4-sulfanyl] 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 139975146 |
| Molecular Formula | C13H15F7O4S2 |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | [(4-methoxyphenyl)methyl-dimethyl-λ4-sulfanyl] 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate |
| SMILES | COc1ccc(CS(C)(C)OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F7O4S2/c1-23-10-6-4-9(5-7-10)8-25(2,3)24-26(21,22)13(19,20)11(14,15)12(16,17)18/h4-7H,8H2,1-3H3 |
| InChIKey | KUSXGIIAUUTNQN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|