C11H8F9NO3S — CID 129295014
1,1,2,2,3,3,4,4,4-nonafluoro-N-(4-methoxyphenyl)butane-1-sulfonamide (PubChem CID 129295014) has the molecular formula C11H8F9NO3S and a molecular weight of 405.24 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluoro-N-(4-methoxyphenyl)butane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N-(4-methoxyphenyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 129295014 |
| Molecular Formula | C11H8F9NO3S |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluoro-N-(4-methoxyphenyl)butane-1-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H8F9NO3S/c1-24-7-4-2-6(3-5-7)21-25(22,23)11(19,20)9(14,15)8(12,13)10(16,17)18/h2-5,21H,1H3 |
| InChIKey | NPYHYMPIDVVMLJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|