C14H12F4N2O5S2 — CID 54199347
2,3,5,6-tetrafluoro-4-(methanesulfonamido)-N-(4-methoxyphenyl)benzenesulfonamide (PubChem CID 54199347) has the molecular formula C14H12F4N2O5S2 and a molecular weight of 428.39 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(methanesulfonamido)-N-(4-methoxyphenyl)benzenesulfonamide.
| Compound Name | 2,3,5,6-tetrafluoro-4-(methanesulfonamido)-N-(4-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 54199347 |
| Molecular Formula | C14H12F4N2O5S2 |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 428.01 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(methanesulfonamido)-N-(4-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2c(F)c(F)c(NS(C)(=O)=O)c(F)c2F)cc1 |
| InChI | InChI=1S/C14H12F4N2O5S2/c1-25-8-5-3-7(4-6-8)19-27(23,24)14-11(17)9(15)13(10(16)12(14)18)20-26(2,21)22/h3-6,19-20H,1-2H3 |
| InChIKey | POCLSEVDBOOLEM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|