C15H10F5NO3S — CID 173031233
2-(4-methoxyphenyl)-N-(2,3,4,5,6-pentafluorophenyl)ethenesulfonamide (PubChem CID 173031233) has the molecular formula C15H10F5NO3S and a molecular weight of 379.31 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-(2,3,4,5,6-pentafluorophenyl)ethenesulfonamide.
| Compound Name | 2-(4-methoxyphenyl)-N-(2,3,4,5,6-pentafluorophenyl)ethenesulfonamide |
|---|---|
| PubChem CID | 173031233 |
| Molecular Formula | C15H10F5NO3S |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-(2,3,4,5,6-pentafluorophenyl)ethenesulfonamide |
| SMILES | COc1ccc(C=CS(=O)(=O)Nc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C15H10F5NO3S/c1-24-9-4-2-8(3-5-9)6-7-25(22,23)21-15-13(19)11(17)10(16)12(18)14(15)20/h2-7,21H,1H3 |
| InChIKey | YTUTYBHCVCDWNX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|