C19H16F2N2O3S — CID 112990245
N-[4-(2,6-difluoroanilino)phenyl]-4-methoxybenzenesulfonamide (PubChem CID 112990245) has the molecular formula C19H16F2N2O3S and a molecular weight of 390.41 g/mol. Its IUPAC name is N-[4-(2,6-difluoroanilino)phenyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[4-(2,6-difluoroanilino)phenyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 112990245 |
| Molecular Formula | C19H16F2N2O3S |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | N-[4-(2,6-difluoroanilino)phenyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(Nc3c(F)cccc3F)cc2)cc1 |
| InChI | InChI=1S/C19H16F2N2O3S/c1-26-15-9-11-16(12-10-15)27(24,25)23-14-7-5-13(6-8-14)22-19-17(20)3-2-4-18(19)21/h2-12,22-23H,1H3 |
| InChIKey | WZOMMIGKJQLQGL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |